Products 5958-08-7
CAS 5958-08-7 appears in our catalog under these names: 6-Chloro-4-phenylquinazoline-2-carboxylic acid, 95%, 6-Chloro-4-phenylquinazoline-2-carboxylic acid, 98+%, 6-Chloro-4-phenylquinazoline-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
6-chloro-4-phenylquinazoline-2-carboxylic acid (CAS 5958-08-7) is a chemical compound with the molecular formula C15H9ClN2O2 and a molecular weight of 284.69 g/mol. IUPAC name: 6-chloro-4-phenylquinazoline-2-carboxylic acid. InChIKey: WOBNNOBIWRSTFY-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O2 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | 6-chloro-4-phenylquinazoline-2-carboxylic acid |
| InChIKey | WOBNNOBIWRSTFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC3=C2C=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)