Products 54904-41-5
CAS 54904-41-5 is the registry number for 2-Chloro-6-nitro-4-phenylquinoline, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
2-chloro-6-nitro-4-phenylquinoline (CAS 54904-41-5) is a chemical compound with the molecular formula C15H9ClN2O2 and a molecular weight of 284.69 g/mol. IUPAC name: 2-chloro-6-nitro-4-phenylquinoline. InChIKey: XQBNZPVYVNNQTL-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O2 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | 2-chloro-6-nitro-4-phenylquinoline |
| InChIKey | XQBNZPVYVNNQTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC3=C2C=C(C=C3)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)