Products 1041059-16-8
CAS 1041059-16-8 appears in our catalog under these names: 2-(2,4-Dimethylphenyl)-1,3-thiazolidine-4-carboxylic acid, 2-(2,4-Dimethylphenyl)thiazolidine-4-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 250mg, 2,5g, 1g, 5g.
2-(2,4-dimethylphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 1041059-16-8) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: WTDGOGLHWOAHSL-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | WTDGOGLHWOAHSL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2NC(CS2)C(=O)O)C |
Computed by PubChem (NCBI)