Products 104115-69-7
CAS 104115-69-7 appears in our catalog under these names: 4-(3,4-Dichlorophenyl)piperidine-2,6-dione, 95%, 4-(3,4-Dichlorophenyl)piperidine-2,6-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(3,4-dichlorophenyl)piperidine-2,6-dione (CAS 104115-69-7) is a chemical compound with the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)piperidine-2,6-dione. InChIKey: LDXFNBWJSQHURH-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO2 |
|---|---|
| Molecular weight | 258.10 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)piperidine-2,6-dione |
| InChIKey | LDXFNBWJSQHURH-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)