CAS 52663-60-2 appears in our catalog under these names: 2,2',3,3',6-Pentachlorobiphenyl, PCB 84, ROTI®Star, 10 mg, glass. Offered by: TRC, Roth. Available pack sizes: 25mg, 10mg.
1,2,4-trichloro-3-(2,3-dichlorophenyl)benzene (CAS 52663-60-2) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,4-trichloro-3-(2,3-dichlorophenyl)benzene. InChIKey: QVWUJLANSDKRAH-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,4-trichloro-3-(2,3-dichlorophenyl)benzene |
| InChIKey | QVWUJLANSDKRAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(C=CC(=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)