CAS 1041333-71-4 is the registry number for Ethyl 5-hydroxy-2-naphthoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-hydroxynaphthalene-2-carboxylate (CAS 1041333-71-4) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: ethyl 5-hydroxynaphthalene-2-carboxylate. InChIKey: LGFMLCVIFWZFTI-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | ethyl 5-hydroxynaphthalene-2-carboxylate |
| InChIKey | LGFMLCVIFWZFTI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C(=CC=C2)O |
Computed by PubChem (NCBI)