CAS 1041422-33-6 is the registry number for Methyl 3-bromo-4H-furo(3,2-b)pyrrole-5-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3-bromo-4H-furo[3,2-b]pyrrole-5-carboxylate (CAS 1041422-33-6) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: methyl 3-bromo-4H-furo[3,2-b]pyrrole-5-carboxylate. InChIKey: NFPLCTCGGPJLPS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | methyl 3-bromo-4H-furo[3,2-b]pyrrole-5-carboxylate |
| InChIKey | NFPLCTCGGPJLPS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C(=CO2)Br |
Computed by PubChem (NCBI)