CAS 1042154-36-8 appears in our catalog under these names: N2,N4-Dimethyl-3-nitropyridine-2,4-diamine, 95%, N2,N4-Dimethyl-3-nitropyridine-2,4-diamine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-N,4-N-dimethyl-3-nitropyridine-2,4-diamine (CAS 1042154-36-8) is a chemical compound with the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. IUPAC name: 2-N,4-N-dimethyl-3-nitropyridine-2,4-diamine. InChIKey: TZKULECVAKNAJY-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O2 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 2-N,4-N-dimethyl-3-nitropyridine-2,4-diamine |
| InChIKey | TZKULECVAKNAJY-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=NC=C1)NC)[N+](=O)[O-] |
Computed by PubChem (NCBI)