CAS 107095-02-3 is the registry number for N4-Methyl-3-nitro-1,2,4-benzenetriamine. Offered by: TRC. Available pack sizes: 5g.
4-N-methyl-3-nitrobenzene-1,2,4-triamine (CAS 107095-02-3) is a chemical compound with the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. IUPAC name: 4-N-methyl-3-nitrobenzene-1,2,4-triamine. InChIKey: PFOBDZBJVDSDGQ-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O2 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 4-N-methyl-3-nitrobenzene-1,2,4-triamine |
| InChIKey | PFOBDZBJVDSDGQ-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=C(C=C1)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)