CAS 858838-90-1 is the registry number for N1-(3-Nitropyridin-4-yl)ethane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N'-(3-nitro-4-pyridinyl)ethane-1,2-diamine (CAS 858838-90-1) is a chemical compound with the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. IUPAC name: N'-(3-nitro-4-pyridinyl)ethane-1,2-diamine. InChIKey: XNRQTPLLVHXKFA-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O2 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | N'-(3-nitro-4-pyridinyl)ethane-1,2-diamine |
| InChIKey | XNRQTPLLVHXKFA-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1NCCN)[N+](=O)[O-] |
Computed by PubChem (NCBI)