CAS 73895-39-3 is the registry number for N2,N6-Dimethyl-3-nitro-pyridine-2,6-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
2-N,6-N-dimethyl-3-nitropyridine-2,6-diamine (CAS 73895-39-3) is a chemical compound with the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. IUPAC name: 2-N,6-N-dimethyl-3-nitropyridine-2,6-diamine. InChIKey: KCSPBYGOSJQPMB-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O2 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 2-N,6-N-dimethyl-3-nitropyridine-2,6-diamine |
| InChIKey | KCSPBYGOSJQPMB-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=C(C=C1)[N+](=O)[O-])NC |
Computed by PubChem (NCBI)