CAS 1378263-50-3 is the registry number for 8-Ethyl-3,4,5,7-tetrahydro-1H-purine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-ethyl-3,4,5,7-tetrahydropurine-2,6-dione (CAS 1378263-50-3) is a chemical compound with the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. IUPAC name: 8-ethyl-3,4,5,7-tetrahydropurine-2,6-dione. InChIKey: FFKGXWZTESWUDG-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O2 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 8-ethyl-3,4,5,7-tetrahydropurine-2,6-dione |
| InChIKey | FFKGXWZTESWUDG-UHFFFAOYSA-N |
| SMILES | CCC1=NC2C(N1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)