CAS 104236-73-9 is the registry number for 3-(4-Hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(4-hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one (CAS 104236-73-9) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: (E)-3-(4-hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one. InChIKey: NGQQEEYHKPKSER-SOFGYWHQSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (E)-3-(4-hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | NGQQEEYHKPKSER-SOFGYWHQSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)C2=CC=CC=C2O)O |
Computed by PubChem (NCBI)