Products 1042440-43-6

CAS 1042440-43-6 is the registry number for 1-(Thiophen-2-ylmethyl)azetidine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(thiophen-2-ylmethyl)azetidine-2-carboxylic acid (CAS 1042440-43-6) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 1-(thiophen-2-ylmethyl)azetidine-2-carboxylic acid. InChIKey: XVKRXQQBVFPBOB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2S
Molecular weight197.26 g/mol
IUPAC name1-(thiophen-2-ylmethyl)azetidine-2-carboxylic acid
InChIKeyXVKRXQQBVFPBOB-UHFFFAOYSA-N
SMILESC1CN(C1C(=O)O)CC2=CC=CS2

Computed by PubChem (NCBI)