Products 104260-73-3
CAS 104260-73-3 is the registry number for Collagen-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5',8'-dihydroxyspiro[cyclopentane-1,4'-naphthalene]-1'-one (CAS 104260-73-3) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 5',8'-dihydroxyspiro[cyclopentane-1,4'-naphthalene]-1'-one. InChIKey: MPSXUFLJWIRFMD-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 5',8'-dihydroxyspiro[cyclopentane-1,4'-naphthalene]-1'-one |
| InChIKey | MPSXUFLJWIRFMD-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C=CC(=O)C3=C(C=CC(=C23)O)O |
Computed by PubChem (NCBI)
Synonyms:
Collagen-IN-1, orb1689713