Products 1042634-08-1
CAS 1042634-08-1 is the registry number for (5-Chloro-2-hydroxyphenyl)(thiomorpholino)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-chloro-2-hydroxyphenyl)-thiomorpholin-4-ylmethanone (CAS 1042634-08-1) is a chemical compound with the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. IUPAC name: (5-chloro-2-hydroxyphenyl)-thiomorpholin-4-ylmethanone. InChIKey: GYKVDWGBEFQFFN-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2S |
|---|---|
| Molecular weight | 257.74 g/mol |
| IUPAC name | (5-chloro-2-hydroxyphenyl)-thiomorpholin-4-ylmethanone |
| InChIKey | GYKVDWGBEFQFFN-UHFFFAOYSA-N |
| SMILES | C1CSCCN1C(=O)C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)