CAS 316829-38-6 is the registry number for 2,3,3-Trimethyl-3H-indole-5-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,3,3-trimethylindole-5-sulfonyl chloride (CAS 316829-38-6) is a chemical compound with the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. IUPAC name: 2,3,3-trimethylindole-5-sulfonyl chloride. InChIKey: VQSNLVAYNDFHID-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2S |
|---|---|
| Molecular weight | 257.74 g/mol |
| IUPAC name | 2,3,3-trimethylindole-5-sulfonyl chloride |
| InChIKey | VQSNLVAYNDFHID-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)