CAS 1423032-77-2 is the registry number for 1-{5-Acetyl-4H,5H,6H,7H-thieno(3,2-c)pyridin-2-yl}-2-chloroethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(5-acetyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)-2-chloroethanone (CAS 1423032-77-2) is a chemical compound with the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. IUPAC name: 1-(5-acetyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)-2-chloroethanone. InChIKey: JQOGBRLFUNTMLR-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2S |
|---|---|
| Molecular weight | 257.74 g/mol |
| IUPAC name | 1-(5-acetyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)-2-chloroethanone |
| InChIKey | JQOGBRLFUNTMLR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C(C1)C=C(S2)C(=O)CCl |
Computed by PubChem (NCBI)