CAS 1258650-71-3 appears in our catalog under these names: Methyl 3-(aminomethyl)-1-benzothiophene-2-carboxylate hydrochloride, Methyl 3-(aminomethyl)-1-benzothiophene-2-carboxylate hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
Methyl 3-(aminomethyl)-1-benzothiophene-2-carboxylate;hydrochloride (CAS 1258650-71-3) is a chemical compound with the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. IUPAC name: methyl 3-(aminomethyl)-1-benzothiophene-2-carboxylate;hydrochloride. InChIKey: ROPZWCSLRQJSTP-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2S |
|---|---|
| Molecular weight | 257.74 g/mol |
| IUPAC name | methyl 3-(aminomethyl)-1-benzothiophene-2-carboxylate;hydrochloride |
| InChIKey | ROPZWCSLRQJSTP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2S1)CN.Cl |
Computed by PubChem (NCBI)