CAS 1430411-09-8 is the registry number for tert-Butyl 2-chloro-4H-thieno[3,2-b]pyrrole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-chlorothieno[3,2-b]pyrrole-4-carboxylate (CAS 1430411-09-8) is a chemical compound with the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. IUPAC name: tert-butyl 2-chlorothieno[3,2-b]pyrrole-4-carboxylate. InChIKey: ZWEFFMFOPKKFPR-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2S |
|---|---|
| Molecular weight | 257.74 g/mol |
| IUPAC name | tert-butyl 2-chlorothieno[3,2-b]pyrrole-4-carboxylate |
| InChIKey | ZWEFFMFOPKKFPR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=C(S2)Cl |
Computed by PubChem (NCBI)