Products 1042641-92-8

CAS 1042641-92-8 is the registry number for 3-(3,4-Difluorophenyl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(3,4-difluorophenyl)butanoic acid (CAS 1042641-92-8) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 3-(3,4-difluorophenyl)butanoic acid. InChIKey: XEGNLSSZSLFSBH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O2
Molecular weight200.18 g/mol
IUPAC name3-(3,4-difluorophenyl)butanoic acid
InChIKeyXEGNLSSZSLFSBH-UHFFFAOYSA-N
SMILESCC(CC(=O)O)C1=CC(=C(C=C1)F)F

Computed by PubChem (NCBI)