CAS 1042722-42-8 is the registry number for 4-Bromo-5,6-dimethoxyisoindolin-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5,6-dimethoxy-2,3-dihydroisoindol-1-one (CAS 1042722-42-8) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: 4-bromo-5,6-dimethoxy-2,3-dihydroisoindol-1-one. InChIKey: KEDCFOZIJJIKRG-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | 4-bromo-5,6-dimethoxy-2,3-dihydroisoindol-1-one |
| InChIKey | KEDCFOZIJJIKRG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2CNC(=O)C2=C1)Br)OC |
Computed by PubChem (NCBI)