CAS 1042796-50-8 is the registry number for (4-Methyl-1,2,3-thiadiazole-5-carbonyl)glycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-methylthiadiazole-5-carbonyl)amino]acetic acid (CAS 1042796-50-8) is a chemical compound with the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. IUPAC name: 2-[(4-methylthiadiazole-5-carbonyl)amino]acetic acid. InChIKey: KHVSFSFVBYTGHX-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3S |
|---|---|
| Molecular weight | 201.21 g/mol |
| IUPAC name | 2-[(4-methylthiadiazole-5-carbonyl)amino]acetic acid |
| InChIKey | KHVSFSFVBYTGHX-UHFFFAOYSA-N |
| SMILES | CC1=C(SN=N1)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)