CAS 2137593-81-6 is the registry number for 7-Methyl-1H,3H,4H,7H-2λâ¶-pyrazolo(3,4-c)(1,2)thiazine-2,2,4-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-methyl-2,2-dioxo-1H-pyrazolo[5,4-c]thiazin-4-one (CAS 2137593-81-6) is a chemical compound with the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. IUPAC name: 7-methyl-2,2-dioxo-1H-pyrazolo[5,4-c]thiazin-4-one. InChIKey: BDUGPWDRZGUSEP-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3S |
|---|---|
| Molecular weight | 201.21 g/mol |
| IUPAC name | 7-methyl-2,2-dioxo-1H-pyrazolo[5,4-c]thiazin-4-one |
| InChIKey | BDUGPWDRZGUSEP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)CS(=O)(=O)N2 |
Computed by PubChem (NCBI)