CAS 343853-74-7 appears in our catalog under these names: Celecoxib Impurity 14, Celecoxib Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-oxohydrazinyl)benzenesulfonamide (CAS 343853-74-7) is a chemical compound with the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. IUPAC name: 4-(2-oxohydrazinyl)benzenesulfonamide. InChIKey: BZCURHCKDOASHG-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3S |
|---|---|
| Molecular weight | 201.21 g/mol |
| IUPAC name | 4-(2-oxohydrazinyl)benzenesulfonamide |
| InChIKey | BZCURHCKDOASHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN=O)S(=O)(=O)N |
Computed by PubChem (NCBI)