Products 139172-80-8
CAS 139172-80-8 is the registry number for Methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate (CAS 139172-80-8) is a chemical compound with the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. IUPAC name: methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate. InChIKey: IBUBKEKAWFVXMI-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3S |
|---|---|
| Molecular weight | 201.21 g/mol |
| IUPAC name | methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate |
| InChIKey | IBUBKEKAWFVXMI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NS1)C(=O)N)N |
Computed by PubChem (NCBI)