CAS 26861-97-2 is the registry number for 4-Oxo-4-(1,3,4-thiadiazol-2-ylamino)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-oxo-4-(1,3,4-thiadiazol-2-ylamino)butanoic acid (CAS 26861-97-2) is a chemical compound with the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. IUPAC name: 4-oxo-4-(1,3,4-thiadiazol-2-ylamino)butanoic acid. InChIKey: JYLCXMIWSXYXNE-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3S |
|---|---|
| Molecular weight | 201.21 g/mol |
| IUPAC name | 4-oxo-4-(1,3,4-thiadiazol-2-ylamino)butanoic acid |
| InChIKey | JYLCXMIWSXYXNE-UHFFFAOYSA-N |
| SMILES | C1=NN=C(S1)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)