CAS 1042798-07-1 is the registry number for 2-{((3-Methyl-1,2-oxazol-5-yl)methyl)sulfanyl}pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyridine-3-carboxylic acid (CAS 1042798-07-1) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyridine-3-carboxylic acid. InChIKey: USCXFIKERNQLEG-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyridine-3-carboxylic acid |
| InChIKey | USCXFIKERNQLEG-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)CSC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)