CAS 929973-36-4 appears in our catalog under these names: 4-([(3-Methyl-1,2,4-oxadiazol-5-yl)methyl]thio)benzoic acid, 95%, 4-{((3-methyl-1,2,4-oxadiazol-5-yl)methyl)sulfanyl}benzoic acid, 95%, 4-{((3-Methyl-1,2,4-oxadiazol-5-yl)methyl)sulfanyl}benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoic acid (CAS 929973-36-4) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoic acid. InChIKey: SSBNRJMZYYGHKI-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoic acid |
| InChIKey | SSBNRJMZYYGHKI-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)CSC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)