CAS 165682-75-7 appears in our catalog under these names: 2-[(4-Methoxyphenyl)amino]-1,3-thiazole-4-carboxylic acid, 95%, 2-((4-Methoxyphenyl)amino)-1,3-thiazole-4-carboxylic acid, 2-(4-Methoxy-phenylamino)-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 2000mg, 1000mg, 100mg, 250mg, 500mg.
2-(4-methoxyanilino)-1,3-thiazole-4-carboxylic acid (CAS 165682-75-7) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: FRHNAQQUMBLASW-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | FRHNAQQUMBLASW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)