CAS 28921-29-1 appears in our catalog under these names: 1-(4-Methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione, 95%, 1-(4-Methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-(4-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 28921-29-1) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: BEXQTUOZCTYWFF-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | BEXQTUOZCTYWFF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=O)CC(=O)NC2=S |
Computed by PubChem (NCBI)