CAS 5624-13-5 appears in our catalog under these names: Phenylthiohydantoin-aspartic acid, 95%, Phenylthiohydantoin–aspartic Acid, Phenylthiohydantoin-aspartic Acid, >95.0%(T), 2-(5-Oxo-1-phenyl-2-thioxoimidazolidin-4-yl)acetic acid, ≥95%, ≥95%, 2-(5-Oxo-1-phenyl-2-thioxoimidazolidin-4-yl)acetic acid, ≥95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)acetic acid (CAS 5624-13-5) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: 2-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)acetic acid. InChIKey: NFUCNAREVSTFNC-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 2-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)acetic acid |
| InChIKey | NFUCNAREVSTFNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(NC2=S)CC(=O)O |
Computed by PubChem (NCBI)