Products 1042814-08-3

CAS 1042814-08-3 is the registry number for 4-(Azepane-1-sulfonamido)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(azepan-1-ylsulfonylamino)butanoic acid (CAS 1042814-08-3) is a chemical compound with the molecular formula C10H20N2O4S and a molecular weight of 264.34 g/mol. IUPAC name: 4-(azepan-1-ylsulfonylamino)butanoic acid. InChIKey: YPXQWFSBRXDLCX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20N2O4S
Molecular weight264.34 g/mol
IUPAC name4-(azepan-1-ylsulfonylamino)butanoic acid
InChIKeyYPXQWFSBRXDLCX-UHFFFAOYSA-N
SMILESC1CCCN(CC1)S(=O)(=O)NCCCC(=O)O

Computed by PubChem (NCBI)