CAS 439585-15-6 is the registry number for N,N-Diethyl-N-((((2-propenyloxy)carbonyl)amino)sulfonyl)ethanaminium. Offered by: TRC. Available pack sizes: 500mg.
1-prop-2-enoxy-N-(triethylazaniumyl)sulfonylmethanimidate (CAS 439585-15-6) is a chemical compound with the molecular formula C10H20N2O4S and a molecular weight of 264.34 g/mol. IUPAC name: 1-prop-2-enoxy-N-(triethylazaniumyl)sulfonylmethanimidate. InChIKey: HQJBVKYKODXQQM-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O4S |
|---|---|
| Molecular weight | 264.34 g/mol |
| IUPAC name | 1-prop-2-enoxy-N-(triethylazaniumyl)sulfonylmethanimidate |
| InChIKey | HQJBVKYKODXQQM-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)S(=O)(=O)N=C([O-])OCC=C |
Computed by PubChem (NCBI)