CAS 2165518-75-0 is the registry number for tert-Butyl (S)-3-sulfamoylpiperidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3S)-3-sulfamoylpiperidine-1-carboxylate (CAS 2165518-75-0) is a chemical compound with the molecular formula C10H20N2O4S and a molecular weight of 264.34 g/mol. IUPAC name: tert-butyl (3S)-3-sulfamoylpiperidine-1-carboxylate. InChIKey: SCXXNCYVUUIURI-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O4S |
|---|---|
| Molecular weight | 264.34 g/mol |
| IUPAC name | tert-butyl (3S)-3-sulfamoylpiperidine-1-carboxylate |
| InChIKey | SCXXNCYVUUIURI-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)S(=O)(=O)N |
Computed by PubChem (NCBI)