CAS 1369503-78-5 appears in our catalog under these names: tert-Butyl 6-amino-1,4-thiazepane-4-carboxylate 1,1-dioxide, 98+%, tert-Butyl 6-amino-1,4-thiazepane-4-carboxylate 1,1-dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl 6-amino-1,1-dioxo-1,4-thiazepane-4-carboxylate (CAS 1369503-78-5) is a chemical compound with the molecular formula C10H20N2O4S and a molecular weight of 264.34 g/mol. IUPAC name: tert-butyl 6-amino-1,1-dioxo-1,4-thiazepane-4-carboxylate. InChIKey: HYCVZLIIBVVNHH-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O4S |
|---|---|
| Molecular weight | 264.34 g/mol |
| IUPAC name | tert-butyl 6-amino-1,1-dioxo-1,4-thiazepane-4-carboxylate |
| InChIKey | HYCVZLIIBVVNHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)CC(C1)N |
Computed by PubChem (NCBI)