CAS 478935-29-4 appears in our catalog under these names: 3–hexyl–1–methyl–1H–imidazol–3–ium hydrogen sulfate, 1-Hexyl-3-methyl-1H-imidazol-3-ium hydrogensulfate 98%, 1-Hexyl-3-methyl-1H-imidazol-3-ium hydrogensulfate, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g.
1-hexyl-3-methylimidazol-3-ium;hydrogen sulfate (CAS 478935-29-4) is a chemical compound with the molecular formula C10H20N2O4S and a molecular weight of 264.34 g/mol. IUPAC name: 1-hexyl-3-methylimidazol-3-ium;hydrogen sulfate. InChIKey: TVCNKZCRZIIOOR-UHFFFAOYSA-M.
| Molecular formula | C10H20N2O4S |
|---|---|
| Molecular weight | 264.34 g/mol |
| IUPAC name | 1-hexyl-3-methylimidazol-3-ium;hydrogen sulfate |
| InChIKey | TVCNKZCRZIIOOR-UHFFFAOYSA-M |
| SMILES | CCCCCCN1C=C[N+](=C1)C.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)