CAS 104369-41-7 is the registry number for 3,5,6-Triphenylpyrazin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5,6-triphenyl-1H-pyrazin-2-one (CAS 104369-41-7) is a chemical compound with the molecular formula C22H16N2O and a molecular weight of 324.4 g/mol. IUPAC name: 3,5,6-triphenyl-1H-pyrazin-2-one. InChIKey: BOEKNTXRAFCHFI-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 3,5,6-triphenyl-1H-pyrazin-2-one |
| InChIKey | BOEKNTXRAFCHFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(C(=O)N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)