Products 2674753-39-8
CAS 2674753-39-8 appears in our catalog under these names: NiCur, 99.11%, NiCur, 98%, NiCur, 99.09%. Offered by: MedChemExpress, Ambeed, Chemat, BLDpharm. Available pack sizes: 5 mg, 25 mg, 10 mg, 100mg, 5mg, 10mg, 25mg, 50mg.
3-[(E)-[(3E)-3-[(3-cyanophenyl)methylidene]-2-oxocyclohexylidene]methyl]benzonitrile (CAS 2674753-39-8) is a chemical compound with the molecular formula C22H16N2O and a molecular weight of 324.4 g/mol. IUPAC name: 3-[(E)-[(3E)-3-[(3-cyanophenyl)methylidene]-2-oxocyclohexylidene]methyl]benzonitrile. InChIKey: LENALXRGKSPEKI-ZIOPAAQOSA-N.
| Molecular formula | C22H16N2O |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 3-[(E)-[(3E)-3-[(3-cyanophenyl)methylidene]-2-oxocyclohexylidene]methyl]benzonitrile |
| InChIKey | LENALXRGKSPEKI-ZIOPAAQOSA-N |
| SMILES | C1C/C(=C\C2=CC(=CC=C2)C#N)/C(=O)/C(=C/C3=CC(=CC=C3)C#N)/C1 |
Computed by PubChem (NCBI)