CAS 380918-51-4 appears in our catalog under these names: Perampanel Impurity 4, Perampanel Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-diphenyl-5-pyridin-2-ylpyridin-2-one (CAS 380918-51-4) is a chemical compound with the molecular formula C22H16N2O and a molecular weight of 324.4 g/mol. IUPAC name: 1,3-diphenyl-5-pyridin-2-ylpyridin-2-one. InChIKey: OBRUTSCSGNDVDC-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 1,3-diphenyl-5-pyridin-2-ylpyridin-2-one |
| InChIKey | OBRUTSCSGNDVDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN(C2=O)C3=CC=CC=C3)C4=CC=CC=N4 |
Computed by PubChem (NCBI)