CAS 207790-00-9 is the registry number for 4-(6-Phenyl-[2,2'-bipyridin]-4-yl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)phenol (CAS 207790-00-9) is a chemical compound with the molecular formula C22H16N2O and a molecular weight of 324.4 g/mol. IUPAC name: 4-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)phenol. InChIKey: LKCJYALCMRAZCD-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 4-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)phenol |
| InChIKey | LKCJYALCMRAZCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC(=C2)C3=CC=C(C=C3)O)C4=CC=CC=N4 |
Computed by PubChem (NCBI)