CAS 108446-64-6 appears in our catalog under these names: 3-Biphenyl-4-yl-1-phenyl-1h-pyrazole-4-carbaldehyde, 95%, 1-Phenyl-3-(4-phenylphenyl)-1H-pyrazole-4-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
1-phenyl-3-(4-phenylphenyl)pyrazole-4-carbaldehyde (CAS 108446-64-6) is a chemical compound with the molecular formula C22H16N2O and a molecular weight of 324.4 g/mol. IUPAC name: 1-phenyl-3-(4-phenylphenyl)pyrazole-4-carbaldehyde. InChIKey: JSKTXJPVXSIUIE-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 1-phenyl-3-(4-phenylphenyl)pyrazole-4-carbaldehyde |
| InChIKey | JSKTXJPVXSIUIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NN(C=C3C=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)