CAS 104373-98-0 appears in our catalog under these names: N-(2-Nitrophenyl)prop-2-enamide, 95%, N-(2-Nitrophenyl)prop-2-enamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(2-nitrophenyl)prop-2-enamide (CAS 104373-98-0) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: N-(2-nitrophenyl)prop-2-enamide. InChIKey: OODUHVPBMHKUKK-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | N-(2-nitrophenyl)prop-2-enamide |
| InChIKey | OODUHVPBMHKUKK-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)