CAS 1043919-81-8 is the registry number for 5-Bromo-2,4-dichlorobenzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-bromo-2,4-dichlorobenzenesulfonyl chloride (CAS 1043919-81-8) is a chemical compound with the molecular formula C6H2BrCl3O2S and a molecular weight of 324.4 g/mol. IUPAC name: 5-bromo-2,4-dichlorobenzenesulfonyl chloride. InChIKey: VMMZBCRKHJULAH-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl3O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 5-bromo-2,4-dichlorobenzenesulfonyl chloride |
| InChIKey | VMMZBCRKHJULAH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)