CAS 1349708-80-0 appears in our catalog under these names: 3-Bromo-2,4-dichlorobenzenesulfonyl chloride, 98%, 3-Bromo-2,4-dichlorobenzene-1-sulfonyl chloride, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
3-bromo-2,4-dichlorobenzenesulfonyl chloride (CAS 1349708-80-0) is a chemical compound with the molecular formula C6H2BrCl3O2S and a molecular weight of 324.4 g/mol. IUPAC name: 3-bromo-2,4-dichlorobenzenesulfonyl chloride. InChIKey: KDSCCBGEIBGKMY-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl3O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 3-bromo-2,4-dichlorobenzenesulfonyl chloride |
| InChIKey | KDSCCBGEIBGKMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1S(=O)(=O)Cl)Cl)Br)Cl |
Computed by PubChem (NCBI)