Products 1208076-85-0

CAS 1208076-85-0 appears in our catalog under these names: 4-Bromo-2,3-dichlorobenzene-1-sulfonyl chloride, 95%, 4-Bromo-2,3-dichlorobenzene-1-sulfonyl chloride, 97%, 4-Bromo-2,3-dichlorobenzenesulfonyl chloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

4-bromo-2,3-dichlorobenzenesulfonyl chloride (CAS 1208076-85-0) is a chemical compound with the molecular formula C6H2BrCl3O2S and a molecular weight of 324.4 g/mol. IUPAC name: 4-bromo-2,3-dichlorobenzenesulfonyl chloride. InChIKey: HRFCMISMANHTAH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrCl3O2S
Molecular weight324.4 g/mol
IUPAC name4-bromo-2,3-dichlorobenzenesulfonyl chloride
InChIKeyHRFCMISMANHTAH-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1S(=O)(=O)Cl)Cl)Cl)Br

Computed by PubChem (NCBI)