CAS 1208076-53-2 appears in our catalog under these names: 4-Bromo-3,5-dichlorobenzene-1-sulfonyl chloride, 97%, 4-Bromo-3,5-dichlorobenzenesulfonyl chloride. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
4-bromo-3,5-dichlorobenzenesulfonyl chloride (CAS 1208076-53-2) is a chemical compound with the molecular formula C6H2BrCl3O2S and a molecular weight of 324.4 g/mol. IUPAC name: 4-bromo-3,5-dichlorobenzenesulfonyl chloride. InChIKey: BUJMSSMOHUYYJH-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl3O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 4-bromo-3,5-dichlorobenzenesulfonyl chloride |
| InChIKey | BUJMSSMOHUYYJH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Br)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)