Products 1208076-53-2

CAS 1208076-53-2 appears in our catalog under these names: 4-Bromo-3,5-dichlorobenzene-1-sulfonyl chloride, 97%, 4-Bromo-3,5-dichlorobenzenesulfonyl chloride. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-bromo-3,5-dichlorobenzenesulfonyl chloride (CAS 1208076-53-2) is a chemical compound with the molecular formula C6H2BrCl3O2S and a molecular weight of 324.4 g/mol. IUPAC name: 4-bromo-3,5-dichlorobenzenesulfonyl chloride. InChIKey: BUJMSSMOHUYYJH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrCl3O2S
Molecular weight324.4 g/mol
IUPAC name4-bromo-3,5-dichlorobenzenesulfonyl chloride
InChIKeyBUJMSSMOHUYYJH-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)Br)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)