CAS 351003-53-7 is the registry number for 2-Bromo-4,6-dichlorobenzenesulfonylchloride, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
2-bromo-4,6-dichlorobenzenesulfonyl chloride (CAS 351003-53-7) is a chemical compound with the molecular formula C6H2BrCl3O2S and a molecular weight of 324.4 g/mol. IUPAC name: 2-bromo-4,6-dichlorobenzenesulfonyl chloride. InChIKey: FWBOGDGDIZUVFT-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl3O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2-bromo-4,6-dichlorobenzenesulfonyl chloride |
| InChIKey | FWBOGDGDIZUVFT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)S(=O)(=O)Cl)Br)Cl |
Computed by PubChem (NCBI)