Products 4590-86-7
CAS 4590-86-7 appears in our catalog under these names: DOCK2–IN–1, DOCK2-IN-1, 96%, 96%, DOCK2-IN-1, 98.29%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 10 mg, 5 mg, 10mM/1mL.
(4E)-4-[(2-chlorophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione (CAS 4590-86-7) is a chemical compound with the molecular formula C16H11ClN2O2 and a molecular weight of 298.72 g/mol. IUPAC name: (4E)-4-[(2-chlorophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione. InChIKey: VEBASGXAFMQOLL-JLHYYAGUSA-N.
| Molecular formula | C16H11ClN2O2 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | (4E)-4-[(2-chlorophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
| InChIKey | VEBASGXAFMQOLL-JLHYYAGUSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)/C(=C/C3=CC=CC=C3Cl)/C(=O)N2 |
Computed by PubChem (NCBI)