CAS 911417-24-8 appears in our catalog under these names: 3-(4-Chloroquinazolin-2-yl)phenyl acetate, 98%, 3-(4-Chloroquinazolin-2-yl)phenyl acetate, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
[3-(4-chloroquinazolin-2-yl)phenyl] acetate (CAS 911417-24-8) is a chemical compound with the molecular formula C16H11ClN2O2 and a molecular weight of 298.72 g/mol. IUPAC name: [3-(4-chloroquinazolin-2-yl)phenyl] acetate. InChIKey: YWMUDDXQSHDRFX-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2O2 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | [3-(4-chloroquinazolin-2-yl)phenyl] acetate |
| InChIKey | YWMUDDXQSHDRFX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=N2)Cl |
Computed by PubChem (NCBI)